CAS 1233188-83-4 appears in our catalog under these names: N-(3-(2-Chloroacetamido)phenyl)benzamide, 95%, N-(3-(2-Chloroacetamido)phenyl)benzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-[3-[(2-chloroacetyl)amino]phenyl]benzamide (CAS 1233188-83-4) is a chemical compound with the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. IUPAC name: N-[3-[(2-chloroacetyl)amino]phenyl]benzamide. InChIKey: DWNHTHNQFOAYLP-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O2 |
|---|---|
| Molecular weight | 288.73 g/mol |
| IUPAC name | N-[3-[(2-chloroacetyl)amino]phenyl]benzamide |
| InChIKey | DWNHTHNQFOAYLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC(=C2)NC(=O)CCl |
Computed by PubChem (NCBI)