Products 5504-71-2
CAS 5504-71-2 is the registry number for 2-Amino-n-(2-benzoyl-4-chlorophenyl)acetamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100g, 1g, 5g, 25g.
2-amino-N-(2-benzoyl-4-chlorophenyl)acetamide (CAS 5504-71-2) is a chemical compound with the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. IUPAC name: 2-amino-N-(2-benzoyl-4-chlorophenyl)acetamide. InChIKey: GIBRATRQHFFRHE-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O2 |
|---|---|
| Molecular weight | 288.73 g/mol |
| IUPAC name | 2-amino-N-(2-benzoyl-4-chlorophenyl)acetamide |
| InChIKey | GIBRATRQHFFRHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)NC(=O)CN |
Computed by PubChem (NCBI)