Products 369606-86-0
CAS 369606-86-0 is the registry number for 6-Chloro-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine (CAS 369606-86-0) is a chemical compound with the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. IUPAC name: 6-chloro-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine. InChIKey: NSQPYKGCGWBTQN-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O2 |
|---|---|
| Molecular weight | 288.73 g/mol |
| IUPAC name | 6-chloro-2-(3,4-dimethoxyphenyl)imidazo[1,2-a]pyridine |
| InChIKey | NSQPYKGCGWBTQN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CN3C=C(C=CC3=N2)Cl)OC |
Computed by PubChem (NCBI)