Products 1269151-08-7
CAS 1269151-08-7 is the registry number for 2-(1H-1,3-Benzodiazol-1-yl)-2-phenylacetic Acid Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(benzimidazol-1-yl)-2-phenylacetic acid;hydrochloride (CAS 1269151-08-7) is a chemical compound with the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. IUPAC name: 2-(benzimidazol-1-yl)-2-phenylacetic acid;hydrochloride. InChIKey: QIYRJDLYQKUEFG-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O2 |
|---|---|
| Molecular weight | 288.73 g/mol |
| IUPAC name | 2-(benzimidazol-1-yl)-2-phenylacetic acid;hydrochloride |
| InChIKey | QIYRJDLYQKUEFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)N2C=NC3=CC=CC=C32.Cl |
Computed by PubChem (NCBI)