Products 78281-73-9
CAS 78281-73-9 is the registry number for AHR-10037. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-amino-3-(4-chlorobenzoyl)phenyl]acetamide (CAS 78281-73-9) is a chemical compound with the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. IUPAC name: 2-[2-amino-3-(4-chlorobenzoyl)phenyl]acetamide. InChIKey: QYWOBAQCODTFCM-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O2 |
|---|---|
| Molecular weight | 288.73 g/mol |
| IUPAC name | 2-[2-amino-3-(4-chlorobenzoyl)phenyl]acetamide |
| InChIKey | QYWOBAQCODTFCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)C2=CC=C(C=C2)Cl)N)CC(=O)N |
Computed by PubChem (NCBI)