CAS 1233243-95-2 is the registry number for Methyl 4-cyano-3-(trifluoromethyl)benzoate, 97%. Offered by: AmBeed. Available pack sizes: 10g.
Methyl 4-cyano-3-(trifluoromethyl)benzoate (CAS 1233243-95-2) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: methyl 4-cyano-3-(trifluoromethyl)benzoate. InChIKey: JUWUUEYPNQOKCX-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | methyl 4-cyano-3-(trifluoromethyl)benzoate |
| InChIKey | JUWUUEYPNQOKCX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)