Products 1233492-49-3

CAS 1233492-49-3 is the registry number for Methyl 3′,4′-difluoro-2′-methoxy-[1,1′-biphenyl]-2-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(3,4-difluoro-2-methoxyphenyl)benzoate (CAS 1233492-49-3) is a chemical compound with the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. IUPAC name: methyl 2-(3,4-difluoro-2-methoxyphenyl)benzoate. InChIKey: AIHYQZJDCUDJTI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12F2O3
Molecular weight278.25 g/mol
IUPAC namemethyl 2-(3,4-difluoro-2-methoxyphenyl)benzoate
InChIKeyAIHYQZJDCUDJTI-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1F)F)C2=CC=CC=C2C(=O)OC

Computed by PubChem (NCBI)