Products 123418-43-9

CAS 123418-43-9 is the registry number for 4-Chloro-5-methylthiophene-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

(4-chloro-5-methylthiophen-2-yl) hydrogen carbonate (CAS 123418-43-9) is a chemical compound with the molecular formula C6H5ClO3S and a molecular weight of 192.62 g/mol. IUPAC name: (4-chloro-5-methylthiophen-2-yl) hydrogen carbonate. InChIKey: ZJDQCQANELVQQG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClO3S
Molecular weight192.62 g/mol
IUPAC name(4-chloro-5-methylthiophen-2-yl) hydrogen carbonate
InChIKeyZJDQCQANELVQQG-UHFFFAOYSA-N
SMILESCC1=C(C=C(S1)OC(=O)O)Cl

Computed by PubChem (NCBI)