Products 98-66-8
CAS 98-66-8 appears in our catalog under these names: 4-Chlorobenzenesulfonic acid, 98%, 4-Chlorobenzenesulfonic acid hydrate, 98%, 4-Chlorobenzenesulfonic acid 98% (contains <5%H2O), 4-Chlorobenzenesulfonic Acid, >95% (HPLC), 4-Chlorobenzenesulfonic Acid, >98.0%(HPLC)(T). Offered by: Combi-blocks, Ambeed, TRC, TCI, Chemat. Available pack sizes: 1kg, 100g, 25g, 500g, 5g, 250g, on request, 1g.
4-chlorobenzenesulfonic acid (CAS 98-66-8) is a chemical compound with the molecular formula C6H5ClO3S and a molecular weight of 192.62 g/mol. IUPAC name: 4-chlorobenzenesulfonic acid. InChIKey: RJWBTWIBUIGANW-UHFFFAOYSA-N.
| Molecular formula | C6H5ClO3S |
|---|---|
| Molecular weight | 192.62 g/mol |
| IUPAC name | 4-chlorobenzenesulfonic acid |
| InChIKey | RJWBTWIBUIGANW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
p-Chlorobenzenesulfonic acid, Benzenesulfonic acid, 4-chloro-, 4-Chlorobenzenesulphonic acid, p-Chlorophenylsulfonic acid, Benzenesulfonic acid, p-chloro-, 4-11-00-00107 (Beilstein Handbook Reference), P-CHLOROBENZENESULFONIC ACID [MI], InChI=1/C6H5ClO3S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H,8,9,10, 4-Chloro-benzenesulfonic acid, 4-chlorobenzene-1-sulfonic acid