Products 27886-58-4
CAS 27886-58-4 appears in our catalog under these names: 2-Chloro-benzenesulfonic acid, 95%, 2-Chlorobenzenesulfonic acid, 95+%, 2–Chlorobenzenesulfonic Acid hydrate, 2-Chlorobenzenesulfonic acid, 95%, 95%, 2-Chlorobenzenesulfonic acid hydrate. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
2-chlorobenzenesulfonic acid (CAS 27886-58-4) is a chemical compound with the molecular formula C6H5ClO3S and a molecular weight of 192.62 g/mol. IUPAC name: 2-chlorobenzenesulfonic acid. InChIKey: MNURPFVONZPVLA-UHFFFAOYSA-N.
| Molecular formula | C6H5ClO3S |
|---|---|
| Molecular weight | 192.62 g/mol |
| IUPAC name | 2-chlorobenzenesulfonic acid |
| InChIKey | MNURPFVONZPVLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)O)Cl |
Computed by PubChem (NCBI)