Products 133659-14-0

CAS 133659-14-0 appears in our catalog under these names: 5–Chloro–4–methoxythiophene–3–carboxylic acid, 5-Chloro-4-methoxythiophene-3-carboxylic acid 95%, 5-Chloro-4-methoxythiophene-3-carboxylic acid, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-chloro-4-methoxythiophene-3-carboxylic acid (CAS 133659-14-0) is a chemical compound with the molecular formula C6H5ClO3S and a molecular weight of 192.62 g/mol. IUPAC name: 5-chloro-4-methoxythiophene-3-carboxylic acid. InChIKey: CEOFOUVVEMMYDW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClO3S
Molecular weight192.62 g/mol
IUPAC name5-chloro-4-methoxythiophene-3-carboxylic acid
InChIKeyCEOFOUVVEMMYDW-UHFFFAOYSA-N
SMILESCOC1=C(SC=C1C(=O)O)Cl

Computed by PubChem (NCBI)