CAS 4025-67-6 appears in our catalog under these names: 4-Hydroxybenzenesulfonyl chloride, 95%, 4-Hydroxybenzenesulfonyl Chloride, 4-Hydroxybenzenesulfonyl chloride 95%, 4-Hydroxybenzenesulfonyl Chloride, 97%, 97%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 500mg, 2g, 100mg.
4-hydroxybenzenesulfonyl chloride (CAS 4025-67-6) is a chemical compound with the molecular formula C6H5ClO3S and a molecular weight of 192.62 g/mol. IUPAC name: 4-hydroxybenzenesulfonyl chloride. InChIKey: XKQZGGLHJYTXJA-UHFFFAOYSA-N.
| Molecular formula | C6H5ClO3S |
|---|---|
| Molecular weight | 192.62 g/mol |
| IUPAC name | 4-hydroxybenzenesulfonyl chloride |
| InChIKey | XKQZGGLHJYTXJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)