CAS 1234615-82-7 appears in our catalog under these names: 2,3-Dimethyl-2H-indazole-5-carboxylic acid, 95%, 2,3-Dimethyl-2H-indazole-5-carboxylic acid, 97%, 2,3-Dimethyl-2H-indazole-5-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 10g, 5g, 500mg.
2,3-dimethylindazole-5-carboxylic acid (CAS 1234615-82-7) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2,3-dimethylindazole-5-carboxylic acid. InChIKey: SCRFWXTZHPULSS-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2,3-dimethylindazole-5-carboxylic acid |
| InChIKey | SCRFWXTZHPULSS-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=CC2=NN1C)C(=O)O |
Computed by PubChem (NCBI)