CAS 1234870-95-1 appears in our catalog under these names: Boc-Trp(6-F)-OH 95%, (S)-2-((tert-Butoxycarbonyl)amino)-3-(6-fluoro-1H-indol-3-yl)propanoic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2S)-3-(6-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1234870-95-1) is a chemical compound with the molecular formula C16H19FN2O4 and a molecular weight of 322.33 g/mol. IUPAC name: (2S)-3-(6-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VVTAJUCNHDSAJU-ZDUSSCGKSA-N.
| Molecular formula | C16H19FN2O4 |
|---|---|
| Molecular weight | 322.33 g/mol |
| IUPAC name | (2S)-3-(6-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VVTAJUCNHDSAJU-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CNC2=C1C=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)