CAS 320581-69-9 is the registry number for Boc-D-Trp(6-F)-OH 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-3-(6-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 320581-69-9) is a chemical compound with the molecular formula C16H19FN2O4 and a molecular weight of 322.33 g/mol. IUPAC name: (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VVTAJUCNHDSAJU-CYBMUJFWSA-N.
| Molecular formula | C16H19FN2O4 |
|---|---|
| Molecular weight | 322.33 g/mol |
| IUPAC name | (2R)-3-(6-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VVTAJUCNHDSAJU-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CNC2=C1C=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)