Products 175212-04-1
CAS 175212-04-1 appears in our catalog under these names: CMI977 (LDP977), CMI977. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, Get quote.
1-[4-[(2S,5S)-5-[(4-fluorophenoxy)methyl]oxolan-2-yl]but-3-ynyl]-1-hydroxyurea (CAS 175212-04-1) is a chemical compound with the molecular formula C16H19FN2O4 and a molecular weight of 322.33 g/mol. IUPAC name: 1-[4-[(2S,5S)-5-[(4-fluorophenoxy)methyl]oxolan-2-yl]but-3-ynyl]-1-hydroxyurea. InChIKey: YANONWCPCKIWEC-CABCVRRESA-N.
| Molecular formula | C16H19FN2O4 |
|---|---|
| Molecular weight | 322.33 g/mol |
| IUPAC name | 1-[4-[(2S,5S)-5-[(4-fluorophenoxy)methyl]oxolan-2-yl]but-3-ynyl]-1-hydroxyurea |
| InChIKey | YANONWCPCKIWEC-CABCVRRESA-N |
| SMILES | C1C[C@H](O[C@@H]1COC2=CC=C(C=C2)F)C#CCCN(C(=O)N)O |
Computed by PubChem (NCBI)