CAS 67308-25-2 is the registry number for 2-((tert-Butoxycarbonyl)amino)-3-(6-fluoro-1H-indol-3-yl)propanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-(6-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 67308-25-2) is a chemical compound with the molecular formula C16H19FN2O4 and a molecular weight of 322.33 g/mol. IUPAC name: 3-(6-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VVTAJUCNHDSAJU-UHFFFAOYSA-N.
| Molecular formula | C16H19FN2O4 |
|---|---|
| Molecular weight | 322.33 g/mol |
| IUPAC name | 3-(6-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VVTAJUCNHDSAJU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CNC2=C1C=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)