CAS 67337-05-7 appears in our catalog under these names: 2–{((tert–Butoxy)carbonyl)amino}–3–(5–fluoro–1H–indol–3–yl)propanoic acid, Boc-DL-Trp(5-F)-OH 97%, 2-((tert-Butoxycarbonyl)amino)-3-(5-fluoro-1H-indol-3-yl)propanoic acid, 97%, 97%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-(5-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 67337-05-7) is a chemical compound with the molecular formula C16H19FN2O4 and a molecular weight of 322.33 g/mol. IUPAC name: 3-(5-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: BSFODZRINGCUSL-UHFFFAOYSA-N.
| Molecular formula | C16H19FN2O4 |
|---|---|
| Molecular weight | 322.33 g/mol |
| IUPAC name | 3-(5-fluoro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | BSFODZRINGCUSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CNC2=C1C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)