Products 1235439-74-3
CAS 1235439-74-3 is the registry number for 1-(3-Chlorophenyl)-1H-pyrazole-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-(3-chlorophenyl)pyrazole-4-carbonitrile (CAS 1235439-74-3) is a chemical compound with the molecular formula C10H6ClN3 and a molecular weight of 203.63 g/mol. IUPAC name: 1-(3-chlorophenyl)pyrazole-4-carbonitrile. InChIKey: GLPMKSMXDTXFQI-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3 |
|---|---|
| Molecular weight | 203.63 g/mol |
| IUPAC name | 1-(3-chlorophenyl)pyrazole-4-carbonitrile |
| InChIKey | GLPMKSMXDTXFQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C=C(C=N2)C#N |
Computed by PubChem (NCBI)