CAS 1235440-61-5 appears in our catalog under these names: 1-(Propan-2-yl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 95%, 1-(Propan-2-yl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 1-Isopropyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 98%, 98%, 1-Isopropyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 1g.
1-propan-2-yl-5-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 1235440-61-5) is a chemical compound with the molecular formula C8H9F3N2O2 and a molecular weight of 222.16 g/mol. IUPAC name: 1-propan-2-yl-5-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: CIPPUTFULIROLY-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O2 |
|---|---|
| Molecular weight | 222.16 g/mol |
| IUPAC name | 1-propan-2-yl-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | CIPPUTFULIROLY-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=C(C=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)