CAS 1236162-23-4 appears in our catalog under these names: 3-Chloroquinolin-5-ol, 95%, 3-Chloroquinolin-5-ol, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
3-chloroquinolin-5-ol (CAS 1236162-23-4) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 3-chloroquinolin-5-ol. InChIKey: XRRSDYYWGCCPPN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-chloroquinolin-5-ol |
| InChIKey | XRRSDYYWGCCPPN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)Cl)C(=C1)O |
Computed by PubChem (NCBI)