CAS 1236222-03-9 is the registry number for 2-Chloro-7-methoxy-1,5-naphthyridine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-7-methoxy-1,5-naphthyridine (CAS 1236222-03-9) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-chloro-7-methoxy-1,5-naphthyridine. InChIKey: FUEZZBXDMNQRLR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-chloro-7-methoxy-1,5-naphthyridine |
| InChIKey | FUEZZBXDMNQRLR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC(=N2)Cl)N=C1 |
Computed by PubChem (NCBI)