Products 1236305-93-3
CAS 1236305-93-3 is the registry number for 1-(2-Chlorophenyl)-2-fluoro-2-methyl-1-propanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-(2-chlorophenyl)-2-fluoro-2-methylpropan-1-one (CAS 1236305-93-3) is a chemical compound with the molecular formula C10H10ClFO and a molecular weight of 200.64 g/mol. IUPAC name: 1-(2-chlorophenyl)-2-fluoro-2-methylpropan-1-one. InChIKey: XIMQIMOZRMQZCP-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO |
|---|---|
| Molecular weight | 200.64 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2-fluoro-2-methylpropan-1-one |
| InChIKey | XIMQIMOZRMQZCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)C1=CC=CC=C1Cl)F |
Computed by PubChem (NCBI)