CAS 1332326-39-2 is the registry number for 4–(3–Chloro–4–fluorophenyl)butan–2–one. Offered by: GLPBio. Available pack sizes: 1g.
4-(3-chloro-4-fluorophenyl)butan-2-one (CAS 1332326-39-2) is a chemical compound with the molecular formula C10H10ClFO and a molecular weight of 200.64 g/mol. IUPAC name: 4-(3-chloro-4-fluorophenyl)butan-2-one. InChIKey: HVENNDNEGFXZQT-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO |
|---|---|
| Molecular weight | 200.64 g/mol |
| IUPAC name | 4-(3-chloro-4-fluorophenyl)butan-2-one |
| InChIKey | HVENNDNEGFXZQT-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)