CAS 2823-19-0 appears in our catalog under these names: Haloperidol Impurity 7, Haloperidol Impurity 8, Haloperidol Impurity 13, 4-Chloro-1-(2-fluorophenyl)butan-1-one 95%, 4-Chloro-1-(2-fluorophenyl)-1-butanone, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
4-chloro-1-(2-fluorophenyl)butan-1-one (CAS 2823-19-0) is a chemical compound with the molecular formula C10H10ClFO and a molecular weight of 200.64 g/mol. IUPAC name: 4-chloro-1-(2-fluorophenyl)butan-1-one. InChIKey: VOCPYEWBWOAVGP-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO |
|---|---|
| Molecular weight | 200.64 g/mol |
| IUPAC name | 4-chloro-1-(2-fluorophenyl)butan-1-one |
| InChIKey | VOCPYEWBWOAVGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CCCCl)F |
Computed by PubChem (NCBI)