CAS 1341641-88-0 appears in our catalog under these names: 1-(3-Chloro-2-fluorophenyl)-2-methylpropan-1-one, 95%, 1-(3-Chloro-2-fluorophenyl)-2-methylpropan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
1-(3-chloro-2-fluorophenyl)-2-methylpropan-1-one (CAS 1341641-88-0) is a chemical compound with the molecular formula C10H10ClFO and a molecular weight of 200.64 g/mol. IUPAC name: 1-(3-chloro-2-fluorophenyl)-2-methylpropan-1-one. InChIKey: QXMKRXIBIHJVHO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO |
|---|---|
| Molecular weight | 200.64 g/mol |
| IUPAC name | 1-(3-chloro-2-fluorophenyl)-2-methylpropan-1-one |
| InChIKey | QXMKRXIBIHJVHO-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=C(C(=CC=C1)Cl)F |
Computed by PubChem (NCBI)