CAS 1814904-27-2 is the registry number for 4-Chloro-4'-fluorobutyrophenone-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 10 mg, 50 mg, 25 mg.
4-chloro-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)butan-1-one (CAS 1814904-27-2) is a chemical compound with the molecular formula C10H10ClFO and a molecular weight of 204.66 g/mol. IUPAC name: 4-chloro-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)butan-1-one. InChIKey: HXAOUYGZEOZTJO-LNFUJOGGSA-N.
| Molecular formula | C10H10ClFO |
|---|---|
| Molecular weight | 204.66 g/mol |
| IUPAC name | 4-chloro-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)butan-1-one |
| InChIKey | HXAOUYGZEOZTJO-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)CCCCl)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)