CAS 1236791-61-9 appears in our catalog under these names: 3-(Azetidin-3-yl)pyridine dihydrochloride, 3-(azetidin-3-yl)pyridine dihydrochloride, 97%, 97%, 3-(Azetidin-3-yl)pyridine dihydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 10g, 100mg, 250mg, 1g.
3-(azetidin-3-yl)pyridine;dihydrochloride (CAS 1236791-61-9) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: 3-(azetidin-3-yl)pyridine;dihydrochloride. InChIKey: PDMZUWJDEZQVHU-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 3-(azetidin-3-yl)pyridine;dihydrochloride |
| InChIKey | PDMZUWJDEZQVHU-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)