Products 1237130-43-6

CAS 1237130-43-6 is the registry number for 4-Cyclopropyl-2-methoxybenzoic acid, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.

4-cyclopropyl-2-methoxybenzoic acid (CAS 1237130-43-6) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 4-cyclopropyl-2-methoxybenzoic acid. InChIKey: HCDCMPFWLQZCPD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC name4-cyclopropyl-2-methoxybenzoic acid
InChIKeyHCDCMPFWLQZCPD-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C2CC2)C(=O)O

Computed by PubChem (NCBI)