CAS 1238869-86-7 appears in our catalog under these names: 3-Methyl-4-(2-thienyl)-1h-pyrazol-5-amine hydrochloride, 95%, 5-Methyl-4-(thiophen-2-yl)-1H-pyrazol-3-amine Hydrochloride, 3-Methyl-4-(thiophen-2-yl)-1H-pyrazol-5-amine hydrochloride, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 1g, 250mg, 500mg, 5g.
5-methyl-4-thiophen-2-yl-1H-pyrazol-3-amine;hydrochloride (CAS 1238869-86-7) is a chemical compound with the molecular formula C8H10ClN3S and a molecular weight of 215.70 g/mol. IUPAC name: 5-methyl-4-thiophen-2-yl-1H-pyrazol-3-amine;hydrochloride. InChIKey: HUMJJRZVXUJGTO-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3S |
|---|---|
| Molecular weight | 215.70 g/mol |
| IUPAC name | 5-methyl-4-thiophen-2-yl-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | HUMJJRZVXUJGTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)N)C2=CC=CS2.Cl |
Computed by PubChem (NCBI)