CAS 944902-03-8 is the registry number for 4-Chloro-5,6,7,8-tetrahydro-2-(methylthio)pyrido[4,3-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (CAS 944902-03-8) is a chemical compound with the molecular formula C8H10ClN3S and a molecular weight of 215.70 g/mol. IUPAC name: 4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine. InChIKey: WOKOJJXVQQKKEU-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3S |
|---|---|
| Molecular weight | 215.70 g/mol |
| IUPAC name | 4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| InChIKey | WOKOJJXVQQKKEU-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(CNCC2)C(=N1)Cl |
Computed by PubChem (NCBI)