CAS 1417287-47-8 is the registry number for 4-Chloro-2-(methylthio)-1,5,6,7-tetrahydropyrido[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine (CAS 1417287-47-8) is a chemical compound with the molecular formula C8H10ClN3S and a molecular weight of 215.70 g/mol. IUPAC name: 4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine. InChIKey: YDFFSHOGZAQBBD-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3S |
|---|---|
| Molecular weight | 215.70 g/mol |
| IUPAC name | 4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine |
| InChIKey | YDFFSHOGZAQBBD-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(CCCN2)C(=N1)Cl |
Computed by PubChem (NCBI)