CAS 951884-05-2 is the registry number for 6-Chloro-4-(N-cyclopropylamino)-2-(methylthio)pyrimidine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.
6-chloro-N-cyclopropyl-2-methylsulfanylpyrimidin-4-amine (CAS 951884-05-2) is a chemical compound with the molecular formula C8H10ClN3S and a molecular weight of 215.70 g/mol. IUPAC name: 6-chloro-N-cyclopropyl-2-methylsulfanylpyrimidin-4-amine. InChIKey: GCUBJNZHGROFOJ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3S |
|---|---|
| Molecular weight | 215.70 g/mol |
| IUPAC name | 6-chloro-N-cyclopropyl-2-methylsulfanylpyrimidin-4-amine |
| InChIKey | GCUBJNZHGROFOJ-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=CC(=N1)Cl)NC2CC2 |
Computed by PubChem (NCBI)