Products 1239692-57-9

CAS 1239692-57-9 is the registry number for 4-Methyl-3-(2-thienyl)-1h-pyrazol-5-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

4-methyl-5-thiophen-2-yl-1H-pyrazol-3-amine;hydrochloride (CAS 1239692-57-9) is a chemical compound with the molecular formula C8H10ClN3S and a molecular weight of 215.70 g/mol. IUPAC name: 4-methyl-5-thiophen-2-yl-1H-pyrazol-3-amine;hydrochloride. InChIKey: SMWBBFQQVBRNNP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClN3S
Molecular weight215.70 g/mol
IUPAC name4-methyl-5-thiophen-2-yl-1H-pyrazol-3-amine;hydrochloride
InChIKeySMWBBFQQVBRNNP-UHFFFAOYSA-N
SMILESCC1=C(NN=C1N)C2=CC=CS2.Cl

Computed by PubChem (NCBI)