CAS 123958-85-0 is the registry number for 2-Methoxy-5-sulfamoylbenzoic Acid-d3. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
5-sulfamoyl-2-(trideuteriomethoxy)benzoic acid (CAS 123958-85-0) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 234.25 g/mol. IUPAC name: 5-sulfamoyl-2-(trideuteriomethoxy)benzoic acid. InChIKey: SQAILWDRVDGLGY-FIBGUPNXSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 5-sulfamoyl-2-(trideuteriomethoxy)benzoic acid |
| InChIKey | SQAILWDRVDGLGY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)