Products 123958-85-0

CAS 123958-85-0 is the registry number for 2-Methoxy-5-sulfamoylbenzoic Acid-d3. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

5-sulfamoyl-2-(trideuteriomethoxy)benzoic acid (CAS 123958-85-0) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 234.25 g/mol. IUPAC name: 5-sulfamoyl-2-(trideuteriomethoxy)benzoic acid. InChIKey: SQAILWDRVDGLGY-FIBGUPNXSA-N.

Identity
Molecular formulaC8H9NO5S
Molecular weight234.25 g/mol
IUPAC name5-sulfamoyl-2-(trideuteriomethoxy)benzoic acid
InChIKeySQAILWDRVDGLGY-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])OC1=C(C=C(C=C1)S(=O)(=O)N)C(=O)O

Computed by PubChem (NCBI)