Products 1313738-12-3
CAS 1313738-12-3 appears in our catalog under these names: 3-fluoro-4-(methoxymethyl)phenylboronic acid, 95%, (3–Fluoro–4–(methoxymethyl)phenyl)boronic acid, (3-fluoro-4-(methoxymethyl)phenyl)boronic acid, (3-Fluoro-4-(methoxymethyl)phenyl)boronic acid, 95%, (3-Fluoro-4-(methoxymethyl)phenyl)boronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 0,5g, 50mg.
[3-fluoro-4-(methoxymethyl)phenyl]boronic acid (CAS 1313738-12-3) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: [3-fluoro-4-(methoxymethyl)phenyl]boronic acid. InChIKey: PSLUSKRGWJLDQM-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | [3-fluoro-4-(methoxymethyl)phenyl]boronic acid |
| InChIKey | PSLUSKRGWJLDQM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)COC)F)(O)O |
Computed by PubChem (NCBI)