Products 1239769-46-0

CAS 1239769-46-0 is the registry number for 1-(2,4-Dichloro-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-(2,4-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate (CAS 1239769-46-0) is a chemical compound with the molecular formula C12H11Cl2NO3 and a molecular weight of 288.12 g/mol. IUPAC name: methyl 1-(2,4-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate. InChIKey: MSTHTQPIUXAOAP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11Cl2NO3
Molecular weight288.12 g/mol
IUPAC namemethyl 1-(2,4-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate
InChIKeyMSTHTQPIUXAOAP-UHFFFAOYSA-N
SMILESCOC(=O)C1CC(=O)N(C1)C2=C(C=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)