CAS 1239769-46-0 is the registry number for 1-(2,4-Dichloro-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 1-(2,4-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate (CAS 1239769-46-0) is a chemical compound with the molecular formula C12H11Cl2NO3 and a molecular weight of 288.12 g/mol. IUPAC name: methyl 1-(2,4-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate. InChIKey: MSTHTQPIUXAOAP-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2NO3 |
|---|---|
| Molecular weight | 288.12 g/mol |
| IUPAC name | methyl 1-(2,4-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| InChIKey | MSTHTQPIUXAOAP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC(=O)N(C1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)