Products 1598370-01-4
CAS 1598370-01-4 is the registry number for Methyl (2z)-3-(2,6-dichlorophenyl)-2-acetamidoprop-2-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (Z)-2-acetamido-3-(2,6-dichlorophenyl)prop-2-enoate (CAS 1598370-01-4) is a chemical compound with the molecular formula C12H11Cl2NO3 and a molecular weight of 288.12 g/mol. IUPAC name: methyl (Z)-2-acetamido-3-(2,6-dichlorophenyl)prop-2-enoate. InChIKey: MIXUEMDODFQRLS-WDZFZDKYSA-N.
| Molecular formula | C12H11Cl2NO3 |
|---|---|
| Molecular weight | 288.12 g/mol |
| IUPAC name | methyl (Z)-2-acetamido-3-(2,6-dichlorophenyl)prop-2-enoate |
| InChIKey | MIXUEMDODFQRLS-WDZFZDKYSA-N |
| SMILES | CC(=O)N/C(=C\C1=C(C=CC=C1Cl)Cl)/C(=O)OC |
Computed by PubChem (NCBI)