Products 744253-60-9
CAS 744253-60-9 appears in our catalog under these names: 1-(3,5-Dichlorobenzoyl)pyrrolidine-2-carboxylic acid, 95%, (3,5-Dichlorobenzoyl)proline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(3,5-dichlorobenzoyl)pyrrolidine-2-carboxylic acid (CAS 744253-60-9) is a chemical compound with the molecular formula C12H11Cl2NO3 and a molecular weight of 288.12 g/mol. IUPAC name: 1-(3,5-dichlorobenzoyl)pyrrolidine-2-carboxylic acid. InChIKey: RANFRUCLCQSCQN-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2NO3 |
|---|---|
| Molecular weight | 288.12 g/mol |
| IUPAC name | 1-(3,5-dichlorobenzoyl)pyrrolidine-2-carboxylic acid |
| InChIKey | RANFRUCLCQSCQN-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)C2=CC(=CC(=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)