Products 919016-51-6
CAS 919016-51-6 is the registry number for 1-(3,4-Dichloro-benzyl)-5-oxo-pyrrolidine-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 919016-51-6) is a chemical compound with the molecular formula C12H11Cl2NO3 and a molecular weight of 288.12 g/mol. IUPAC name: 1-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: QIQQYWCDOVFAOA-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2NO3 |
|---|---|
| Molecular weight | 288.12 g/mol |
| IUPAC name | 1-[(3,4-dichlorophenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | QIQQYWCDOVFAOA-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)