Products 62559-51-7
CAS 62559-51-7 is the registry number for 1-(3,4-Dichlorobenzoyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.
1-(3,4-dichlorobenzoyl)pyrrolidine-2-carboxylic acid (CAS 62559-51-7) is a chemical compound with the molecular formula C12H11Cl2NO3 and a molecular weight of 288.12 g/mol. IUPAC name: 1-(3,4-dichlorobenzoyl)pyrrolidine-2-carboxylic acid. InChIKey: ZHVCKMSAEWCLOO-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2NO3 |
|---|---|
| Molecular weight | 288.12 g/mol |
| IUPAC name | 1-(3,4-dichlorobenzoyl)pyrrolidine-2-carboxylic acid |
| InChIKey | ZHVCKMSAEWCLOO-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)