CAS 1240287-91-5 is the registry number for 3-Bromo-4-fluoro-N,N-dimethylbenzenesulfonamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-bromo-4-fluoro-N,N-dimethylbenzenesulfonamide (CAS 1240287-91-5) is a chemical compound with the molecular formula C8H9BrFNO2S and a molecular weight of 282.13 g/mol. IUPAC name: 3-bromo-4-fluoro-N,N-dimethylbenzenesulfonamide. InChIKey: UEIQIHHUAPFUBL-UHFFFAOYSA-N.
| Molecular formula | C8H9BrFNO2S |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 3-bromo-4-fluoro-N,N-dimethylbenzenesulfonamide |
| InChIKey | UEIQIHHUAPFUBL-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)F)Br |
Computed by PubChem (NCBI)