Products 1311368-91-8

CAS 1311368-91-8 is the registry number for tert-Butyl 6-methyl-1,2,3-oxathiazinane-3-carboxylate 2,2-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Tert-butyl 6-methyl-2,2-dioxooxathiazinane-3-carboxylate (CAS 1311368-91-8) is a chemical compound with the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. IUPAC name: tert-butyl 6-methyl-2,2-dioxooxathiazinane-3-carboxylate. InChIKey: CIFMHARJEMLUFC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO5S
Molecular weight251.30 g/mol
IUPAC nametert-butyl 6-methyl-2,2-dioxooxathiazinane-3-carboxylate
InChIKeyCIFMHARJEMLUFC-UHFFFAOYSA-N
SMILESCC1CCN(S(=O)(=O)O1)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)