CAS 1240480-36-7 appears in our catalog under these names: (S)-2-Amino-2-(3-fluorophenyl)ethanol hydrochloride, 95%, (S)–2–Amino–2–(3–fluorophenyl)ethanol hydrochloride, (S)-2-amino-2-(3-fluorophenyl)ethanol hydrochloride, (S)-2-Amino-2-(3-fluorophenyl)ethanol hydrochloride 97%, (S)-2-Amino-2-(3-fluorophenyl)ethanol hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 2,5g.
(2S)-2-amino-2-(3-fluorophenyl)ethanol;hydrochloride (CAS 1240480-36-7) is a chemical compound with the molecular formula C8H11ClFNO and a molecular weight of 191.63 g/mol. IUPAC name: (2S)-2-amino-2-(3-fluorophenyl)ethanol;hydrochloride. InChIKey: VJMNCZRJJLXISS-DDWIOCJRSA-N.
| Molecular formula | C8H11ClFNO |
|---|---|
| Molecular weight | 191.63 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-fluorophenyl)ethanol;hydrochloride |
| InChIKey | VJMNCZRJJLXISS-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)