CAS 1311314-06-3 appears in our catalog under these names: 2-Amino-2-(3-fluorophenyl)ethan-1-ol hydrochloride, 95%, 2-Amino-2-(3-fluorophenyl)ethan-1-ol hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-amino-2-(3-fluorophenyl)ethanol;hydrochloride (CAS 1311314-06-3) is a chemical compound with the molecular formula C8H11ClFNO and a molecular weight of 191.63 g/mol. IUPAC name: 2-amino-2-(3-fluorophenyl)ethanol;hydrochloride. InChIKey: VJMNCZRJJLXISS-UHFFFAOYSA-N.
| Molecular formula | C8H11ClFNO |
|---|---|
| Molecular weight | 191.63 g/mol |
| IUPAC name | 2-amino-2-(3-fluorophenyl)ethanol;hydrochloride |
| InChIKey | VJMNCZRJJLXISS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(CO)N.Cl |
Computed by PubChem (NCBI)