CAS 1240526-55-9 appears in our catalog under these names: 2-{6,8-dichloroimidazo(1,2-a)pyridin-2-yl}ethanethioamide, 95%, 2-{6,8-Dichloroimidazo(1,2-a)pyridin-2-yl}ethanethioamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)ethanethioamide (CAS 1240526-55-9) is a chemical compound with the molecular formula C9H7Cl2N3S and a molecular weight of 260.14 g/mol. IUPAC name: 2-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)ethanethioamide. InChIKey: CURPYPSEJIFOTB-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3S |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 2-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)ethanethioamide |
| InChIKey | CURPYPSEJIFOTB-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=CN2C=C1Cl)CC(=S)N)Cl |
Computed by PubChem (NCBI)