CAS 725217-53-8 is the registry number for 5-(3,4-Dichlorophenyl)-4-methyl-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
3-(3,4-dichlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione (CAS 725217-53-8) is a chemical compound with the molecular formula C9H7Cl2N3S and a molecular weight of 260.14 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: QCGPGOVIOSTXGK-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3S |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | QCGPGOVIOSTXGK-UHFFFAOYSA-N |
| SMILES | CN1C(=NNC1=S)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)