Products 930580-28-2
CAS 930580-28-2 is the registry number for 5-(2,5-Dichloropyrimidin-4-yl)-2,4-dimethylthiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,5-dichloropyrimidin-4-yl)-2,4-dimethyl-1,3-thiazole (CAS 930580-28-2) is a chemical compound with the molecular formula C9H7Cl2N3S and a molecular weight of 260.14 g/mol. IUPAC name: 5-(2,5-dichloropyrimidin-4-yl)-2,4-dimethyl-1,3-thiazole. InChIKey: FAVODWHIVQIAKD-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3S |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 5-(2,5-dichloropyrimidin-4-yl)-2,4-dimethyl-1,3-thiazole |
| InChIKey | FAVODWHIVQIAKD-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)C2=NC(=NC=C2Cl)Cl |
Computed by PubChem (NCBI)