CAS 162693-41-6 appears in our catalog under these names: 5-(2,4-Dichlorophenyl)-4-methyl-4h-1,2,4-triazole-3-thiol, 95%, 5-(2,4-Dichlorophenyl)-4-methyl-4H-1,2,4-triazole-3-thiol, 97%, 5-(2,4-dichlorophenyl)-4-methyl-4H-1,2,4-triazole-3-thiol. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
3-(2,4-dichlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione (CAS 162693-41-6) is a chemical compound with the molecular formula C9H7Cl2N3S and a molecular weight of 260.14 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: KNPVHXREFIERGC-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3S |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | KNPVHXREFIERGC-UHFFFAOYSA-N |
| SMILES | CN1C(=NNC1=S)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)