CAS 39181-52-7 is the registry number for 5-(2,4-Dichlorobenzyl)-1,3,4-thiadiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-[(2,4-dichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine (CAS 39181-52-7) is a chemical compound with the molecular formula C9H7Cl2N3S and a molecular weight of 260.14 g/mol. IUPAC name: 5-[(2,4-dichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine. InChIKey: VWFJPGHKRXMPGJ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3S |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 5-[(2,4-dichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | VWFJPGHKRXMPGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CC2=NN=C(S2)N |
Computed by PubChem (NCBI)